C20H28N6OS — CID 30936494
1-[3-[4-[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]ethylamino]piperidin-1-yl]phenyl]pyrrolidin-2-one (PubChem CID 30936494) has the molecular formula C20H28N6OS and a molecular weight of 400.55 g/mol. Its IUPAC name is 1-[3-[4-[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]ethylamino]piperidin-1-yl]phenyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[4-[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]ethylamino]piperidin-1-yl]phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 30936494 |
| Molecular Formula | C20H28N6OS |
| Molecular Weight | 400.55 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | 1-[3-[4-[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]ethylamino]piperidin-1-yl]phenyl]pyrrolidin-2-one |
| SMILES | Cn1cnnc1SCCNC1CCN(c2cccc(N3CCCC3=O)c2)CC1 |
| InChI | InChI=1S/C20H28N6OS/c1-24-15-22-23-20(24)28-13-9-21-16-7-11-25(12-8-16)17-4-2-5-18(14-17)26-10-3-6-19(26)27/h2,4-5,14-16,21H,3,6-13H2,1H3 |
| InChIKey | YICZDJUZOVXQKE-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.55 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|