C18H15F3N4O4S2 — CID 30940888
N-(4-sulfamoylphenyl)-2-[2-[4-(trifluoromethoxy)anilino]-1,3-thiazol-4-yl]acetamide (PubChem CID 30940888) has the molecular formula C18H15F3N4O4S2 and a molecular weight of 472.47 g/mol. Its IUPAC name is N-(4-sulfamoylphenyl)-2-[2-[4-(trifluoromethoxy)anilino]-1,3-thiazol-4-yl]acetamide.
| Compound Name | N-(4-sulfamoylphenyl)-2-[2-[4-(trifluoromethoxy)anilino]-1,3-thiazol-4-yl]acetamide |
|---|---|
| PubChem CID | 30940888 |
| Molecular Formula | C18H15F3N4O4S2 |
| Molecular Weight | 472.47 g/mol |
| Exact Mass | 472.05 |
| IUPAC Name | N-(4-sulfamoylphenyl)-2-[2-[4-(trifluoromethoxy)anilino]-1,3-thiazol-4-yl]acetamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)Cc2csc(Nc3ccc(OC(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C18H15F3N4O4S2/c19-18(20,21)29-14-5-1-12(2-6-14)24-17-25-13(10-30-17)9-16(26)23-11-3-7-15(8-4-11)31(22,27)28/h1-8,10H,9H2,(H,23,26)(H,24,25)(H2,22,27,28) |
| InChIKey | SIEWWFIHCXNSNU-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 123.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.47 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |