C18H23NO4S2 — CID 30944339
4-methoxy-2-methyl-N-[(4-thiophen-2-yloxan-4-yl)methyl]benzenesulfonamide (PubChem CID 30944339) has the molecular formula C18H23NO4S2 and a molecular weight of 381.52 g/mol. Its IUPAC name is 4-methoxy-2-methyl-N-[(4-thiophen-2-yloxan-4-yl)methyl]benzenesulfonamide.
| Compound Name | 4-methoxy-2-methyl-N-[(4-thiophen-2-yloxan-4-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 30944339 |
| Molecular Formula | C18H23NO4S2 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 4-methoxy-2-methyl-N-[(4-thiophen-2-yloxan-4-yl)methyl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCC2(c3cccs3)CCOCC2)c(C)c1 |
| InChI | InChI=1S/C18H23NO4S2/c1-14-12-15(22-2)5-6-16(14)25(20,21)19-13-18(7-9-23-10-8-18)17-4-3-11-24-17/h3-6,11-12,19H,7-10,13H2,1-2H3 |
| InChIKey | LTGHEOSYMFJTSV-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |