C16H18FNO3S2 — CID 30944278
2-fluoro-N-[(4-thiophen-2-yloxan-4-yl)methyl]benzenesulfonamide (PubChem CID 30944278) has the molecular formula C16H18FNO3S2 and a molecular weight of 355.46 g/mol. Its IUPAC name is 2-fluoro-N-[(4-thiophen-2-yloxan-4-yl)methyl]benzenesulfonamide.
| Compound Name | 2-fluoro-N-[(4-thiophen-2-yloxan-4-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 30944278 |
| Molecular Formula | C16H18FNO3S2 |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | 2-fluoro-N-[(4-thiophen-2-yloxan-4-yl)methyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCC1(c2cccs2)CCOCC1)c1ccccc1F |
| InChI | InChI=1S/C16H18FNO3S2/c17-13-4-1-2-5-14(13)23(19,20)18-12-16(7-9-21-10-8-16)15-6-3-11-22-15/h1-6,11,18H,7-10,12H2 |
| InChIKey | NHVQDZGWOKSBQZ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |