C18H19F2NO4S2 — CID 72717858
2-(difluoromethylsulfonyl)-N-[(4-thiophen-2-yloxan-4-yl)methyl]benzamide (PubChem CID 72717858) has the molecular formula C18H19F2NO4S2 and a molecular weight of 415.48 g/mol. Its IUPAC name is 2-(difluoromethylsulfonyl)-N-[(4-thiophen-2-yloxan-4-yl)methyl]benzamide.
| Compound Name | 2-(difluoromethylsulfonyl)-N-[(4-thiophen-2-yloxan-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 72717858 |
| Molecular Formula | C18H19F2NO4S2 |
| Molecular Weight | 415.48 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | 2-(difluoromethylsulfonyl)-N-[(4-thiophen-2-yloxan-4-yl)methyl]benzamide |
| SMILES | O=C(NCC1(c2cccs2)CCOCC1)c1ccccc1S(=O)(=O)C(F)F |
| InChI | InChI=1S/C18H19F2NO4S2/c19-17(20)27(23,24)14-5-2-1-4-13(14)16(22)21-12-18(7-9-25-10-8-18)15-6-3-11-26-15/h1-6,11,17H,7-10,12H2,(H,21,22) |
| InChIKey | VNJPVFMZOWIBER-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.48 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |