C18H19F2NO3S2 — CID 71806714
2-(difluoromethylsulfonyl)-N-[(1-thiophen-2-ylcyclopentyl)methyl]benzamide (PubChem CID 71806714) has the molecular formula C18H19F2NO3S2 and a molecular weight of 399.48 g/mol. Its IUPAC name is 2-(difluoromethylsulfonyl)-N-[(1-thiophen-2-ylcyclopentyl)methyl]benzamide.
| Compound Name | 2-(difluoromethylsulfonyl)-N-[(1-thiophen-2-ylcyclopentyl)methyl]benzamide |
|---|---|
| PubChem CID | 71806714 |
| Molecular Formula | C18H19F2NO3S2 |
| Molecular Weight | 399.48 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | 2-(difluoromethylsulfonyl)-N-[(1-thiophen-2-ylcyclopentyl)methyl]benzamide |
| SMILES | O=C(NCC1(c2cccs2)CCCC1)c1ccccc1S(=O)(=O)C(F)F |
| InChI | InChI=1S/C18H19F2NO3S2/c19-17(20)26(23,24)14-7-2-1-6-13(14)16(22)21-12-18(9-3-4-10-18)15-8-5-11-25-15/h1-2,5-8,11,17H,3-4,9-10,12H2,(H,21,22) |
| InChIKey | KJTXVMPUWIFHIQ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.48 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |