C21H17NO3S2 — CID 3096741
[4-[(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] 3-methylbenzoate (PubChem CID 3096741) has the molecular formula C21H17NO3S2 and a molecular weight of 395.51 g/mol. Its IUPAC name is [4-[(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] 3-methylbenzoate.
| Compound Name | [4-[(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] 3-methylbenzoate |
|---|---|
| PubChem CID | 3096741 |
| Molecular Formula | C21H17NO3S2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | [4-[(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] 3-methylbenzoate |
| SMILES | C=CCN1C(=O)C(=Cc2ccc(OC(=O)c3cccc(C)c3)cc2)SC1=S |
| InChI | InChI=1S/C21H17NO3S2/c1-3-11-22-19(23)18(27-21(22)26)13-15-7-9-17(10-8-15)25-20(24)16-6-4-5-14(2)12-16/h3-10,12-13H,1,11H2,2H3 |
| InChIKey | BIONRCRUWCYWSD-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|