C20H13Cl2NO3S2 — CID 2258166
[4-[(E)-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] 2,4-dichlorobenzoate (PubChem CID 2258166) has the molecular formula C20H13Cl2NO3S2 and a molecular weight of 450.37 g/mol. Its IUPAC name is [4-[(E)-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] 2,4-dichlorobenzoate.
| Compound Name | [4-[(E)-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 2258166 |
| Molecular Formula | C20H13Cl2NO3S2 |
| Molecular Weight | 450.37 g/mol |
| Exact Mass | 448.97 |
| IUPAC Name | [4-[(E)-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] 2,4-dichlorobenzoate |
| SMILES | C=CCN1C(=O)/C(=C\c2ccc(OC(=O)c3ccc(Cl)cc3Cl)cc2)SC1=S |
| InChI | InChI=1S/C20H13Cl2NO3S2/c1-2-9-23-18(24)17(28-20(23)27)10-12-3-6-14(7-4-12)26-19(25)15-8-5-13(21)11-16(15)22/h2-8,10-11H,1,9H2/b17-10+ |
| InChIKey | WLFTZBZBBOKFSH-LICLKQGHSA-N |
| XLogP | 5.60 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.37 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|