C11H7ClN4O4 — CID 3097916
N-(4-chlorophenyl)-3,5-dinitropyridin-2-amine (PubChem CID 3097916) has the molecular formula C11H7ClN4O4 and a molecular weight of 294.65 g/mol. Its IUPAC name is N-(4-chlorophenyl)-3,5-dinitropyridin-2-amine.
| Compound Name | N-(4-chlorophenyl)-3,5-dinitropyridin-2-amine |
|---|---|
| PubChem CID | 3097916 |
| Molecular Formula | C11H7ClN4O4 |
| Molecular Weight | 294.65 g/mol |
| Exact Mass | 294.02 |
| IUPAC Name | N-(4-chlorophenyl)-3,5-dinitropyridin-2-amine |
| SMILES | O=[N+]([O-])c1cnc(Nc2ccc(Cl)cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H7ClN4O4/c12-7-1-3-8(4-2-7)14-11-10(16(19)20)5-9(6-13-11)15(17)18/h1-6H,(H,13,14) |
| InChIKey | LBIVAXWKEDSDHK-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 111.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.65 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|