C13H15ClFNO2 — CID 30980101
methyl (2S)-1-[(2-chloro-6-fluorophenyl)methyl]pyrrolidine-2-carboxylate (PubChem CID 30980101) has the molecular formula C13H15ClFNO2 and a molecular weight of 271.72 g/mol. Its IUPAC name is methyl (2S)-1-[(2-chloro-6-fluorophenyl)methyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S)-1-[(2-chloro-6-fluorophenyl)methyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 30980101 |
| Molecular Formula | C13H15ClFNO2 |
| Molecular Weight | 271.72 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | methyl (2S)-1-[(2-chloro-6-fluorophenyl)methyl]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1CCCN1Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C13H15ClFNO2/c1-18-13(17)12-6-3-7-16(12)8-9-10(14)4-2-5-11(9)15/h2,4-5,12H,3,6-8H2,1H3/t12-/m0/s1 |
| InChIKey | PLLLCHLTUMGYEZ-LBPRGKRZSA-N |
| XLogP | 2.62 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.72 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |