C18H18F6N2O4 — CID 3098412
1,1,1,3,3,3-hexafluoropropan-2-yl 6-methyl-2-oxo-4-(4-propoxyphenyl)-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 3098412) has the molecular formula C18H18F6N2O4 and a molecular weight of 440.34 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 6-methyl-2-oxo-4-(4-propoxyphenyl)-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 6-methyl-2-oxo-4-(4-propoxyphenyl)-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 3098412 |
| Molecular Formula | C18H18F6N2O4 |
| Molecular Weight | 440.34 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 6-methyl-2-oxo-4-(4-propoxyphenyl)-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCCOc1ccc(C2NC(=O)NC(C)=C2C(=O)OC(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H18F6N2O4/c1-3-8-29-11-6-4-10(5-7-11)13-12(9(2)25-16(28)26-13)14(27)30-15(17(19,20)21)18(22,23)24/h4-7,13,15H,3,8H2,1-2H3,(H2,25,26,28) |
| InChIKey | DBKQOQITEVFLQJ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.34 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |