C17H17F5N2O4 — CID 7097653
2,2,3,3,3-pentafluoropropyl (4S)-4-(4-ethoxyphenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 7097653) has the molecular formula C17H17F5N2O4 and a molecular weight of 408.32 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoropropyl (4S)-4-(4-ethoxyphenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | 2,2,3,3,3-pentafluoropropyl (4S)-4-(4-ethoxyphenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 7097653 |
| Molecular Formula | C17H17F5N2O4 |
| Molecular Weight | 408.32 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | 2,2,3,3,3-pentafluoropropyl (4S)-4-(4-ethoxyphenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOc1ccc([C@@H]2NC(=O)NC(C)=C2C(=O)OCC(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H17F5N2O4/c1-3-27-11-6-4-10(5-7-11)13-12(9(2)23-15(26)24-13)14(25)28-8-16(18,19)17(20,21)22/h4-7,13H,3,8H2,1-2H3,(H2,23,24,26)/t13-/m0/s1 |
| InChIKey | GCKVCCCQEVFIII-ZDUSSCGKSA-N |
| XLogP | 3.45 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.32 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|