C16H16BrN3O5 — CID 3098535
N-[2-[2-[(5-bromo-3-ethoxy-2-hydroxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]furan-2-carboxamide (PubChem CID 3098535) has the molecular formula C16H16BrN3O5 and a molecular weight of 410.22 g/mol. Its IUPAC name is N-[2-[2-[(5-bromo-3-ethoxy-2-hydroxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]furan-2-carboxamide.
| Compound Name | N-[2-[2-[(5-bromo-3-ethoxy-2-hydroxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 3098535 |
| Molecular Formula | C16H16BrN3O5 |
| Molecular Weight | 410.22 g/mol |
| Exact Mass | 409.03 |
| IUPAC Name | N-[2-[2-[(5-bromo-3-ethoxy-2-hydroxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]furan-2-carboxamide |
| SMILES | CCOc1cc(Br)cc(C=NNC(=O)CNC(=O)c2ccco2)c1O |
| InChI | InChI=1S/C16H16BrN3O5/c1-2-24-13-7-11(17)6-10(15(13)22)8-19-20-14(21)9-18-16(23)12-4-3-5-25-12/h3-8,22H,2,9H2,1H3,(H,18,23)(H,20,21) |
| InChIKey | WPXQPQWPMYEGRE-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 113.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.22 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|