C19H25N5O3S — CID 30991883
(E)-N-[4-(4-ethylpiperazin-1-yl)sulfonylphenyl]-3-(1-methylpyrazol-4-yl)prop-2-enamide (PubChem CID 30991883) has the molecular formula C19H25N5O3S and a molecular weight of 403.51 g/mol. Its IUPAC name is (E)-N-[4-(4-ethylpiperazin-1-yl)sulfonylphenyl]-3-(1-methylpyrazol-4-yl)prop-2-enamide.
| Compound Name | (E)-N-[4-(4-ethylpiperazin-1-yl)sulfonylphenyl]-3-(1-methylpyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 30991883 |
| Molecular Formula | C19H25N5O3S |
| Molecular Weight | 403.51 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | (E)-N-[4-(4-ethylpiperazin-1-yl)sulfonylphenyl]-3-(1-methylpyrazol-4-yl)prop-2-enamide |
| SMILES | CCN1CCN(S(=O)(=O)c2ccc(NC(=O)/C=C/c3cnn(C)c3)cc2)CC1 |
| InChI | InChI=1S/C19H25N5O3S/c1-3-23-10-12-24(13-11-23)28(26,27)18-7-5-17(6-8-18)21-19(25)9-4-16-14-20-22(2)15-16/h4-9,14-15H,3,10-13H2,1-2H3,(H,21,25)/b9-4+ |
| InChIKey | ZDWIYIJKRTZQAB-RUDMXATFSA-N |
| XLogP | 1.40 |
| TPSA | 87.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.51 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|