C25H21IN4 — CID 3099335
N-[1-(4-iodophenyl)ethylideneamino]-N-methyl-4,6-diphenylpyrimidin-2-amine (PubChem CID 3099335) has the molecular formula C25H21IN4 and a molecular weight of 504.38 g/mol. Its IUPAC name is N-[1-(4-iodophenyl)ethylideneamino]-N-methyl-4,6-diphenylpyrimidin-2-amine.
| Compound Name | N-[1-(4-iodophenyl)ethylideneamino]-N-methyl-4,6-diphenylpyrimidin-2-amine |
|---|---|
| PubChem CID | 3099335 |
| Molecular Formula | C25H21IN4 |
| Molecular Weight | 504.38 g/mol |
| Exact Mass | 504.08 |
| IUPAC Name | N-[1-(4-iodophenyl)ethylideneamino]-N-methyl-4,6-diphenylpyrimidin-2-amine |
| SMILES | CC(=NN(C)c1nc(-c2ccccc2)cc(-c2ccccc2)n1)c1ccc(I)cc1 |
| InChI | InChI=1S/C25H21IN4/c1-18(19-13-15-22(26)16-14-19)29-30(2)25-27-23(20-9-5-3-6-10-20)17-24(28-25)21-11-7-4-8-12-21/h3-17H,1-2H3 |
| InChIKey | IJEKLVWMEVRVPI-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 41.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.38 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|