C24H28N4S — CID 3099412
2-benzylsulfanyl-N-[1-(4-pentylphenyl)ethylideneamino]pyrimidin-4-amine (PubChem CID 3099412) has the molecular formula C24H28N4S and a molecular weight of 404.58 g/mol. Its IUPAC name is 2-benzylsulfanyl-N-[1-(4-pentylphenyl)ethylideneamino]pyrimidin-4-amine.
| Compound Name | 2-benzylsulfanyl-N-[1-(4-pentylphenyl)ethylideneamino]pyrimidin-4-amine |
|---|---|
| PubChem CID | 3099412 |
| Molecular Formula | C24H28N4S |
| Molecular Weight | 404.58 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 2-benzylsulfanyl-N-[1-(4-pentylphenyl)ethylideneamino]pyrimidin-4-amine |
| SMILES | CCCCCc1ccc(C(C)=NNc2ccnc(SCc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C24H28N4S/c1-3-4-6-9-20-12-14-22(15-13-20)19(2)27-28-23-16-17-25-24(26-23)29-18-21-10-7-5-8-11-21/h5,7-8,10-17H,3-4,6,9,18H2,1-2H3,(H,25,26,28) |
| InChIKey | ZRYBDABARRFNMP-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 50.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.58 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|