C17H27NO — CID 3100236
2-(4-benzyl-2-propan-2-yloxan-4-yl)ethanamine (PubChem CID 3100236) has the molecular formula C17H27NO and a molecular weight of 261.41 g/mol. Its IUPAC name is 2-(4-benzyl-2-propan-2-yloxan-4-yl)ethanamine.
| Compound Name | 2-(4-benzyl-2-propan-2-yloxan-4-yl)ethanamine |
|---|---|
| PubChem CID | 3100236 |
| Molecular Formula | C17H27NO |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | 2-(4-benzyl-2-propan-2-yloxan-4-yl)ethanamine |
| SMILES | CC(C)C1CC(CCN)(Cc2ccccc2)CCO1 |
| InChI | InChI=1S/C17H27NO/c1-14(2)16-13-17(8-10-18,9-11-19-16)12-15-6-4-3-5-7-15/h3-7,14,16H,8-13,18H2,1-2H3 |
| InChIKey | WSXVXVYATOMEAJ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |