C27H29N5O — CID 31007808
N-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]-2-(2-phenylindol-1-yl)acetamide (PubChem CID 31007808) has the molecular formula C27H29N5O and a molecular weight of 439.56 g/mol. Its IUPAC name is N-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]-2-(2-phenylindol-1-yl)acetamide.
| Compound Name | N-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]-2-(2-phenylindol-1-yl)acetamide |
|---|---|
| PubChem CID | 31007808 |
| Molecular Formula | C27H29N5O |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | N-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]-2-(2-phenylindol-1-yl)acetamide |
| SMILES | CN1CCN(c2ccc(CNC(=O)Cn3c(-c4ccccc4)cc4ccccc43)cn2)CC1 |
| InChI | InChI=1S/C27H29N5O/c1-30-13-15-31(16-14-30)26-12-11-21(18-28-26)19-29-27(33)20-32-24-10-6-5-9-23(24)17-25(32)22-7-3-2-4-8-22/h2-12,17-18H,13-16,19-20H2,1H3,(H,29,33) |
| InChIKey | BPFCXPMLIXFLBR-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |