C17H25N7S — CID 31017687
4-[[1-[(1-pyrimidin-2-ylpiperidin-4-yl)methyl]triazol-4-yl]methyl]thiomorpholine (PubChem CID 31017687) has the molecular formula C17H25N7S and a molecular weight of 359.50 g/mol. Its IUPAC name is 4-[[1-[(1-pyrimidin-2-ylpiperidin-4-yl)methyl]triazol-4-yl]methyl]thiomorpholine.
| Compound Name | 4-[[1-[(1-pyrimidin-2-ylpiperidin-4-yl)methyl]triazol-4-yl]methyl]thiomorpholine |
|---|---|
| PubChem CID | 31017687 |
| Molecular Formula | C17H25N7S |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | 4-[[1-[(1-pyrimidin-2-ylpiperidin-4-yl)methyl]triazol-4-yl]methyl]thiomorpholine |
| SMILES | c1cnc(N2CCC(Cn3cc(CN4CCSCC4)nn3)CC2)nc1 |
| InChI | InChI=1S/C17H25N7S/c1-4-18-17(19-5-1)23-6-2-15(3-7-23)12-24-14-16(20-21-24)13-22-8-10-25-11-9-22/h1,4-5,14-15H,2-3,6-13H2 |
| InChIKey | OJHFLWGKQMQWFA-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 62.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |