C25H34N4OS — CID 31018641
(E)-N-[[1-(1-methylpiperidin-4-yl)piperidin-4-yl]methyl]-N-(pyridin-4-ylmethyl)-3-thiophen-2-ylprop-2-enamide (PubChem CID 31018641) has the molecular formula C25H34N4OS and a molecular weight of 438.64 g/mol. Its IUPAC name is (E)-N-[[1-(1-methylpiperidin-4-yl)piperidin-4-yl]methyl]-N-(pyridin-4-ylmethyl)-3-thiophen-2-ylprop-2-enamide.
| Compound Name | (E)-N-[[1-(1-methylpiperidin-4-yl)piperidin-4-yl]methyl]-N-(pyridin-4-ylmethyl)-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 31018641 |
| Molecular Formula | C25H34N4OS |
| Molecular Weight | 438.64 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | (E)-N-[[1-(1-methylpiperidin-4-yl)piperidin-4-yl]methyl]-N-(pyridin-4-ylmethyl)-3-thiophen-2-ylprop-2-enamide |
| SMILES | CN1CCC(N2CCC(CN(Cc3ccncc3)C(=O)/C=C/c3cccs3)CC2)CC1 |
| InChI | InChI=1S/C25H34N4OS/c1-27-14-10-23(11-15-27)28-16-8-22(9-17-28)20-29(19-21-6-12-26-13-7-21)25(30)5-4-24-3-2-18-31-24/h2-7,12-13,18,22-23H,8-11,14-17,19-20H2,1H3/b5-4+ |
| InChIKey | SZYSPHXJQSDWKP-SNAWJCMRSA-N |
| XLogP | 3.99 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.64 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|