C26H35N3O — CID 56706021
N-[(1-cyclopentylpiperidin-4-yl)methyl]-2-(3-methylphenyl)-N-(pyridin-3-ylmethyl)acetamide (PubChem CID 56706021) has the molecular formula C26H35N3O and a molecular weight of 405.59 g/mol. Its IUPAC name is N-[(1-cyclopentylpiperidin-4-yl)methyl]-2-(3-methylphenyl)-N-(pyridin-3-ylmethyl)acetamide.
| Compound Name | N-[(1-cyclopentylpiperidin-4-yl)methyl]-2-(3-methylphenyl)-N-(pyridin-3-ylmethyl)acetamide |
|---|---|
| PubChem CID | 56706021 |
| Molecular Formula | C26H35N3O |
| Molecular Weight | 405.59 g/mol |
| Exact Mass | 405.28 |
| IUPAC Name | N-[(1-cyclopentylpiperidin-4-yl)methyl]-2-(3-methylphenyl)-N-(pyridin-3-ylmethyl)acetamide |
| SMILES | Cc1cccc(CC(=O)N(Cc2cccnc2)CC2CCN(C3CCCC3)CC2)c1 |
| InChI | InChI=1S/C26H35N3O/c1-21-6-4-7-23(16-21)17-26(30)29(20-24-8-5-13-27-18-24)19-22-11-14-28(15-12-22)25-9-2-3-10-25/h4-8,13,16,18,22,25H,2-3,9-12,14-15,17,19-20H2,1H3 |
| InChIKey | LFJNWUFOQMBJHL-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.59 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |