C23H35N3O3 — CID 42518002
methyl 5-[(1-cyclopentylpiperidin-4-yl)methyl-(pyridin-3-ylmethyl)amino]-5-oxopentanoate (PubChem CID 42518002) has the molecular formula C23H35N3O3 and a molecular weight of 401.55 g/mol. Its IUPAC name is methyl 5-[(1-cyclopentylpiperidin-4-yl)methyl-(pyridin-3-ylmethyl)amino]-5-oxopentanoate.
| Compound Name | methyl 5-[(1-cyclopentylpiperidin-4-yl)methyl-(pyridin-3-ylmethyl)amino]-5-oxopentanoate |
|---|---|
| PubChem CID | 42518002 |
| Molecular Formula | C23H35N3O3 |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.27 |
| IUPAC Name | methyl 5-[(1-cyclopentylpiperidin-4-yl)methyl-(pyridin-3-ylmethyl)amino]-5-oxopentanoate |
| SMILES | COC(=O)CCCC(=O)N(Cc1cccnc1)CC1CCN(C2CCCC2)CC1 |
| InChI | InChI=1S/C23H35N3O3/c1-29-23(28)10-4-9-22(27)26(18-20-6-5-13-24-16-20)17-19-11-14-25(15-12-19)21-7-2-3-8-21/h5-6,13,16,19,21H,2-4,7-12,14-15,17-18H2,1H3 |
| InChIKey | QQYZXDOGSDCPGL-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |