C14H20N2O4S — CID 61460740
methyl 4-[cyclopropyl(pyridin-3-ylmethyl)sulfamoyl]butanoate (PubChem CID 61460740) has the molecular formula C14H20N2O4S and a molecular weight of 312.39 g/mol. Its IUPAC name is methyl 4-[cyclopropyl(pyridin-3-ylmethyl)sulfamoyl]butanoate.
| Compound Name | methyl 4-[cyclopropyl(pyridin-3-ylmethyl)sulfamoyl]butanoate |
|---|---|
| PubChem CID | 61460740 |
| Molecular Formula | C14H20N2O4S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | methyl 4-[cyclopropyl(pyridin-3-ylmethyl)sulfamoyl]butanoate |
| SMILES | COC(=O)CCCS(=O)(=O)N(Cc1cccnc1)C1CC1 |
| InChI | InChI=1S/C14H20N2O4S/c1-20-14(17)5-3-9-21(18,19)16(13-6-7-13)11-12-4-2-8-15-10-12/h2,4,8,10,13H,3,5-7,9,11H2,1H3 |
| InChIKey | TZMBPESUMCOLCP-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |