C18H20N6OS — CID 31042566
(3S)-3-[(4-pyridin-4-yltriazol-1-yl)methyl]-N-thiophen-3-ylpiperidine-1-carboxamide (PubChem CID 31042566) has the molecular formula C18H20N6OS and a molecular weight of 368.47 g/mol. Its IUPAC name is (3S)-3-[(4-pyridin-4-yltriazol-1-yl)methyl]-N-thiophen-3-ylpiperidine-1-carboxamide.
| Compound Name | (3S)-3-[(4-pyridin-4-yltriazol-1-yl)methyl]-N-thiophen-3-ylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 31042566 |
| Molecular Formula | C18H20N6OS |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | (3S)-3-[(4-pyridin-4-yltriazol-1-yl)methyl]-N-thiophen-3-ylpiperidine-1-carboxamide |
| SMILES | O=C(Nc1ccsc1)N1CCC[C@H](Cn2cc(-c3ccncc3)nn2)C1 |
| InChI | InChI=1S/C18H20N6OS/c25-18(20-16-5-9-26-13-16)23-8-1-2-14(10-23)11-24-12-17(21-22-24)15-3-6-19-7-4-15/h3-7,9,12-14H,1-2,8,10-11H2,(H,20,25)/t14-/m0/s1 |
| InChIKey | DGVAEHGTHNENPC-AWEZNQCLSA-N |
| XLogP | 3.35 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |