C15H21N5O2S — CID 31126037
4-[[4-(methoxymethyl)triazol-1-yl]methyl]-N-thiophen-3-ylpiperidine-1-carboxamide (PubChem CID 31126037) has the molecular formula C15H21N5O2S and a molecular weight of 335.43 g/mol. Its IUPAC name is 4-[[4-(methoxymethyl)triazol-1-yl]methyl]-N-thiophen-3-ylpiperidine-1-carboxamide.
| Compound Name | 4-[[4-(methoxymethyl)triazol-1-yl]methyl]-N-thiophen-3-ylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 31126037 |
| Molecular Formula | C15H21N5O2S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 4-[[4-(methoxymethyl)triazol-1-yl]methyl]-N-thiophen-3-ylpiperidine-1-carboxamide |
| SMILES | COCc1cn(CC2CCN(C(=O)Nc3ccsc3)CC2)nn1 |
| InChI | InChI=1S/C15H21N5O2S/c1-22-10-14-9-20(18-17-14)8-12-2-5-19(6-3-12)15(21)16-13-4-7-23-11-13/h4,7,9,11-12H,2-3,5-6,8,10H2,1H3,(H,16,21) |
| InChIKey | RFDDAOKFBXXUOO-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |