C13H28N3O6S- — CID 3104960
N-ethyl-N-[2-hydroxy-3-[(2-hydroxy-3-morpholin-4-ylpropyl)-methylamino]propyl]sulfamate (PubChem CID 3104960) has the molecular formula C13H28N3O6S- and a molecular weight of 354.45 g/mol. Its IUPAC name is N-ethyl-N-[2-hydroxy-3-[(2-hydroxy-3-morpholin-4-ylpropyl)-methylamino]propyl]sulfamate.
| Compound Name | N-ethyl-N-[2-hydroxy-3-[(2-hydroxy-3-morpholin-4-ylpropyl)-methylamino]propyl]sulfamate |
|---|---|
| PubChem CID | 3104960 |
| Molecular Formula | C13H28N3O6S- |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | N-ethyl-N-[2-hydroxy-3-[(2-hydroxy-3-morpholin-4-ylpropyl)-methylamino]propyl]sulfamate |
| SMILES | CCN(CC(O)CN(C)CC(O)CN1CCOCC1)S(=O)(=O)[O-] |
| InChI | InChI=1S/C13H29N3O6S/c1-3-16(23(19,20)21)11-13(18)9-14(2)8-12(17)10-15-4-6-22-7-5-15/h12-13,17-18H,3-11H2,1-2H3,(H,19,20,21)/p-1 |
| InChIKey | UAHZPQZSATWLTO-UHFFFAOYSA-M |
| XLogP | -2.25 |
| TPSA | 116.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|