About 5,10-diiodo-2-(3-nitrophenyl)-1H-phenanthro[9,10-d]imidazole
5,10-diiodo-2-(3-nitrophenyl)-1H-phenanthro[9,10-d]imidazole (PubChem CID 3106584) has the molecular formula C21H11I2N3O2
and a molecular weight of 591.15 g/mol. Its IUPAC name is 5,10-diiodo-2-(3-nitrophenyl)-1H-phenanthro[9,10-d]imidazole.
Molecular Properties
| Compound Name | 5,10-diiodo-2-(3-nitrophenyl)-1H-phenanthro[9,10-d]imidazole |
| PubChem CID | 3106584 |
| Molecular Formula | C21H11I2N3O2 |
| Molecular Weight | 591.15 g/mol |
| Exact Mass | 590.89 |
| IUPAC Name | 5,10-diiodo-2-(3-nitrophenyl)-1H-phenanthro[9,10-d]imidazole |
| SMILES | O=[N+]([O-])c1cccc(-c2nc3c4cc(I)ccc4c4ccc(I)cc4c3[nH]2)c1 |
| InChI | InChI=1S/C21H11I2N3O2/c22-12-4-6-15-16-7-5-13(23)10-18(16)20-19(17(15)9-12)24-21(25-20)11-2-1-3-14(8-11)26(27)28/h1-10H,(H,24,25) |
| InChIKey | JYQAKWICJUCBNK-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 71.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 591.15 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 5,10-diiodo-2-(3-nitrophenyl)-1H-phenanthro[9,10-d]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,10-diiodo-2-(3-nitrophenyl)-1H-phenanthro[9,10-d]imidazole?
The IUPAC name of 5,10-diiodo-2-(3-nitrophenyl)-1H-phenanthro[9,10-d]imidazole (CID 3106584) is 5,10-diiodo-2-(3-nitrophenyl)-1H-phenanthro[9,10-d]imidazole.
What is the SMILES notation for 5,10-diiodo-2-(3-nitrophenyl)-1H-phenanthro[9,10-d]imidazole?
The canonical SMILES for 5,10-diiodo-2-(3-nitrophenyl)-1H-phenanthro[9,10-d]imidazole is O=[N+]([O-])c1cccc(-c2nc3c4cc(I)ccc4c4ccc(I)cc4c3[nH]2)c1.
What is the InChIKey of 5,10-diiodo-2-(3-nitrophenyl)-1H-phenanthro[9,10-d]imidazole?
The InChIKey is JYQAKWICJUCBNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H11I2N3O2/c22-12-4-6-15-16-7-5-13(23)10-18(16)20-19(17(15)9-12)24-21(25-20)11-2-1-3-14(8-11)26(27)28/h1-10H,(H,24,25).
What are the key properties of 5,10-diiodo-2-(3-nitrophenyl)-1H-phenanthro[9,10-d]imidazole?
5,10-diiodo-2-(3-nitrophenyl)-1H-phenanthro[9,10-d]imidazole has a molecular weight of 591.15 g/mol, XLogP of 6.65, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,10-diiodo-2-(3-nitrophenyl)-1H-phenanthro[9,10-d]imidazole is sourced from PubChem (CID 3106584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).