C28H40O6 — CID 3107301
2,3-bis[2-(3-methyl-4-propan-2-ylphenoxy)ethoxy]-1,4-dioxane (PubChem CID 3107301) has the molecular formula C28H40O6 and a molecular weight of 472.62 g/mol. Its IUPAC name is 2,3-bis[2-(3-methyl-4-propan-2-ylphenoxy)ethoxy]-1,4-dioxane.
| Compound Name | 2,3-bis[2-(3-methyl-4-propan-2-ylphenoxy)ethoxy]-1,4-dioxane |
|---|---|
| PubChem CID | 3107301 |
| Molecular Formula | C28H40O6 |
| Molecular Weight | 472.62 g/mol |
| Exact Mass | 472.28 |
| IUPAC Name | 2,3-bis[2-(3-methyl-4-propan-2-ylphenoxy)ethoxy]-1,4-dioxane |
| SMILES | Cc1cc(OCCOC2OCCOC2OCCOc2ccc(C(C)C)c(C)c2)ccc1C(C)C |
| InChI | InChI=1S/C28H40O6/c1-19(2)25-9-7-23(17-21(25)5)29-11-13-31-27-28(34-16-15-33-27)32-14-12-30-24-8-10-26(20(3)4)22(6)18-24/h7-10,17-20,27-28H,11-16H2,1-6H3 |
| InChIKey | MXJODWHZNDWEPC-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.62 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|