C19H28N2O4 — CID 31085477
[4-[(2R)-2-hydroxy-3-(3-methylphenoxy)propyl]piperazin-1-yl]-[(2S)-oxolan-2-yl]methanone (PubChem CID 31085477) has the molecular formula C19H28N2O4 and a molecular weight of 348.44 g/mol. Its IUPAC name is [4-[(2R)-2-hydroxy-3-(3-methylphenoxy)propyl]piperazin-1-yl]-[(2S)-oxolan-2-yl]methanone.
| Compound Name | [4-[(2R)-2-hydroxy-3-(3-methylphenoxy)propyl]piperazin-1-yl]-[(2S)-oxolan-2-yl]methanone |
|---|---|
| PubChem CID | 31085477 |
| Molecular Formula | C19H28N2O4 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | [4-[(2R)-2-hydroxy-3-(3-methylphenoxy)propyl]piperazin-1-yl]-[(2S)-oxolan-2-yl]methanone |
| SMILES | Cc1cccc(OC[C@H](O)CN2CCN(C(=O)[C@@H]3CCCO3)CC2)c1 |
| InChI | InChI=1S/C19H28N2O4/c1-15-4-2-5-17(12-15)25-14-16(22)13-20-7-9-21(10-8-20)19(23)18-6-3-11-24-18/h2,4-5,12,16,18,22H,3,6-11,13-14H2,1H3/t16-,18+/m1/s1 |
| InChIKey | XCQCYZIFCZJFBD-AEFFLSMTSA-N |
| XLogP | 1.06 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |