C17H16N6O4 — CID 3108790
4-amino-N'-(4-methylphenyl)-N-[(2-nitrophenyl)methoxy]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 3108790) has the molecular formula C17H16N6O4 and a molecular weight of 368.35 g/mol. Its IUPAC name is 4-amino-N'-(4-methylphenyl)-N-[(2-nitrophenyl)methoxy]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | 4-amino-N'-(4-methylphenyl)-N-[(2-nitrophenyl)methoxy]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 3108790 |
| Molecular Formula | C17H16N6O4 |
| Molecular Weight | 368.35 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 4-amino-N'-(4-methylphenyl)-N-[(2-nitrophenyl)methoxy]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | Cc1ccc(/N=C(/NOCc2ccccc2[N+](=O)[O-])c2nonc2N)cc1 |
| InChI | InChI=1S/C17H16N6O4/c1-11-6-8-13(9-7-11)19-17(15-16(18)21-27-20-15)22-26-10-12-4-2-3-5-14(12)23(24)25/h2-9H,10H2,1H3,(H2,18,21)(H,19,22) |
| InChIKey | KCRYQTTZKHJRNN-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 141.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.35 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|