C7H8F3N3O2 — CID 3109473
4-methoxy-6-(2,2,2-trifluoroethoxy)pyrimidin-2-amine (PubChem CID 3109473) has the molecular formula C7H8F3N3O2 and a molecular weight of 223.15 g/mol. Its IUPAC name is 4-methoxy-6-(2,2,2-trifluoroethoxy)pyrimidin-2-amine.
| Compound Name | 4-methoxy-6-(2,2,2-trifluoroethoxy)pyrimidin-2-amine |
|---|---|
| PubChem CID | 3109473 |
| Molecular Formula | C7H8F3N3O2 |
| Molecular Weight | 223.15 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | 4-methoxy-6-(2,2,2-trifluoroethoxy)pyrimidin-2-amine |
| SMILES | COc1cc(OCC(F)(F)F)nc(N)n1 |
| InChI | InChI=1S/C7H8F3N3O2/c1-14-4-2-5(13-6(11)12-4)15-3-7(8,9)10/h2H,3H2,1H3,(H2,11,12,13) |
| InChIKey | SALSWBKYZMNLET-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.15 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |