C22H16BrF3N4O5S — CID 3109606
2-[N-(benzenesulfonyl)-4-bromo-2-nitroanilino]-N-[[3-(trifluoromethyl)phenyl]methylideneamino]acetamide (PubChem CID 3109606) has the molecular formula C22H16BrF3N4O5S and a molecular weight of 585.36 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-4-bromo-2-nitroanilino]-N-[[3-(trifluoromethyl)phenyl]methylideneamino]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-4-bromo-2-nitroanilino]-N-[[3-(trifluoromethyl)phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 3109606 |
| Molecular Formula | C22H16BrF3N4O5S |
| Molecular Weight | 585.36 g/mol |
| Exact Mass | 584.00 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-4-bromo-2-nitroanilino]-N-[[3-(trifluoromethyl)phenyl]methylideneamino]acetamide |
| SMILES | O=C(CN(c1ccc(Br)cc1[N+](=O)[O-])S(=O)(=O)c1ccccc1)NN=Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H16BrF3N4O5S/c23-17-9-10-19(20(12-17)30(32)33)29(36(34,35)18-7-2-1-3-8-18)14-21(31)28-27-13-15-5-4-6-16(11-15)22(24,25)26/h1-13H,14H2,(H,28,31) |
| InChIKey | CMJOWVSLIJXUQR-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 121.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.36 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|