C27H17N3O10 — CID 3110866
bis[2-(4-nitrophenyl)-2-oxoethyl] quinoline-2,4-dicarboxylate (PubChem CID 3110866) has the molecular formula C27H17N3O10 and a molecular weight of 543.44 g/mol. Its IUPAC name is bis[2-(4-nitrophenyl)-2-oxoethyl] quinoline-2,4-dicarboxylate.
| Compound Name | bis[2-(4-nitrophenyl)-2-oxoethyl] quinoline-2,4-dicarboxylate |
|---|---|
| PubChem CID | 3110866 |
| Molecular Formula | C27H17N3O10 |
| Molecular Weight | 543.44 g/mol |
| Exact Mass | 543.09 |
| IUPAC Name | bis[2-(4-nitrophenyl)-2-oxoethyl] quinoline-2,4-dicarboxylate |
| SMILES | O=C(COC(=O)c1cc(C(=O)OCC(=O)c2ccc([N+](=O)[O-])cc2)c2ccccc2n1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C27H17N3O10/c31-24(16-5-9-18(10-6-16)29(35)36)14-39-26(33)21-13-23(28-22-4-2-1-3-20(21)22)27(34)40-15-25(32)17-7-11-19(12-8-17)30(37)38/h1-13H,14-15H2 |
| InChIKey | CAIVARPXBZXGBM-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 185.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.44 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|