C17H16O6S2 — CID 31109269
methyl 3-[[(1S)-1,7-dimethyl-3-oxo-1,2-dihydroinden-4-yl]oxysulfonyl]thiophene-2-carboxylate (PubChem CID 31109269) has the molecular formula C17H16O6S2 and a molecular weight of 380.44 g/mol. Its IUPAC name is methyl 3-[[(1S)-1,7-dimethyl-3-oxo-1,2-dihydroinden-4-yl]oxysulfonyl]thiophene-2-carboxylate.
| Compound Name | methyl 3-[[(1S)-1,7-dimethyl-3-oxo-1,2-dihydroinden-4-yl]oxysulfonyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 31109269 |
| Molecular Formula | C17H16O6S2 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.04 |
| IUPAC Name | methyl 3-[[(1S)-1,7-dimethyl-3-oxo-1,2-dihydroinden-4-yl]oxysulfonyl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1S(=O)(=O)Oc1ccc(C)c2c1C(=O)C[C@@H]2C |
| InChI | InChI=1S/C17H16O6S2/c1-9-4-5-12(15-11(18)8-10(2)14(9)15)23-25(20,21)13-6-7-24-16(13)17(19)22-3/h4-7,10H,8H2,1-3H3/t10-/m0/s1 |
| InChIKey | HQNKOLMUSWCMLK-JTQLQIEISA-N |
| XLogP | 3.30 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|