C17H14N3O8- — CID 3111059
3-hydroxy-3-(3-nitrophenyl)-2-[[2-(4-nitrophenyl)acetyl]amino]propanoate (PubChem CID 3111059) has the molecular formula C17H14N3O8- and a molecular weight of 388.31 g/mol. Its IUPAC name is 3-hydroxy-3-(3-nitrophenyl)-2-[[2-(4-nitrophenyl)acetyl]amino]propanoate.
| Compound Name | 3-hydroxy-3-(3-nitrophenyl)-2-[[2-(4-nitrophenyl)acetyl]amino]propanoate |
|---|---|
| PubChem CID | 3111059 |
| Molecular Formula | C17H14N3O8- |
| Molecular Weight | 388.31 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | 3-hydroxy-3-(3-nitrophenyl)-2-[[2-(4-nitrophenyl)acetyl]amino]propanoate |
| SMILES | O=C(Cc1ccc([N+](=O)[O-])cc1)NC(C(=O)[O-])C(O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H15N3O8/c21-14(8-10-4-6-12(7-5-10)19(25)26)18-15(17(23)24)16(22)11-2-1-3-13(9-11)20(27)28/h1-7,9,15-16,22H,8H2,(H,18,21)(H,23,24)/p-1 |
| InChIKey | UKYVEAGJZRGRAS-UHFFFAOYSA-M |
| XLogP | 0.01 |
| TPSA | 175.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.31 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|