C17H15N2O6- — CID 6938834
(2R,3S)-3-hydroxy-3-(3-nitrophenyl)-2-[(2-phenylacetyl)amino]propanoate (PubChem CID 6938834) has the molecular formula C17H15N2O6- and a molecular weight of 343.31 g/mol. Its IUPAC name is (2R,3S)-3-hydroxy-3-(3-nitrophenyl)-2-[(2-phenylacetyl)amino]propanoate.
| Compound Name | (2R,3S)-3-hydroxy-3-(3-nitrophenyl)-2-[(2-phenylacetyl)amino]propanoate |
|---|---|
| PubChem CID | 6938834 |
| Molecular Formula | C17H15N2O6- |
| Molecular Weight | 343.31 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | (2R,3S)-3-hydroxy-3-(3-nitrophenyl)-2-[(2-phenylacetyl)amino]propanoate |
| SMILES | O=C(Cc1ccccc1)N[C@@H](C(=O)[O-])[C@@H](O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H16N2O6/c20-14(9-11-5-2-1-3-6-11)18-15(17(22)23)16(21)12-7-4-8-13(10-12)19(24)25/h1-8,10,15-16,21H,9H2,(H,18,20)(H,22,23)/p-1/t15-,16+/m1/s1 |
| InChIKey | RENAMBKOZOYKFB-CVEARBPZSA-M |
| XLogP | 0.11 |
| TPSA | 132.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.31 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|