C17H23NO — CID 3111211
N-(2,4,6-trimethylphenyl)bicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 3111211) has the molecular formula C17H23NO and a molecular weight of 257.38 g/mol. Its IUPAC name is N-(2,4,6-trimethylphenyl)bicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | N-(2,4,6-trimethylphenyl)bicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 3111211 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | N-(2,4,6-trimethylphenyl)bicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | Cc1cc(C)c(NC(=O)C2CC3CCC2C3)c(C)c1 |
| InChI | InChI=1S/C17H23NO/c1-10-6-11(2)16(12(3)7-10)18-17(19)15-9-13-4-5-14(15)8-13/h6-7,13-15H,4-5,8-9H2,1-3H3,(H,18,19) |
| InChIKey | SIQGKPGBLYKQBB-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |