C14H12F5NO — CID 3670052
N-(2,3,4,5,6-pentafluorophenyl)bicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 3670052) has the molecular formula C14H12F5NO and a molecular weight of 305.25 g/mol. Its IUPAC name is N-(2,3,4,5,6-pentafluorophenyl)bicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | N-(2,3,4,5,6-pentafluorophenyl)bicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 3670052 |
| Molecular Formula | C14H12F5NO |
| Molecular Weight | 305.25 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | N-(2,3,4,5,6-pentafluorophenyl)bicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | O=C(Nc1c(F)c(F)c(F)c(F)c1F)C1CC2CCC1C2 |
| InChI | InChI=1S/C14H12F5NO/c15-8-9(16)11(18)13(12(19)10(8)17)20-14(21)7-4-5-1-2-6(7)3-5/h5-7H,1-4H2,(H,20,21) |
| InChIKey | WLONARPOOHGIJA-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.25 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|