C20H21NO3 — CID 31114025
[(1S)-3-oxo-2-[(2S)-4-phenylbutan-2-yl]-1H-isoindol-1-yl] acetate (PubChem CID 31114025) has the molecular formula C20H21NO3 and a molecular weight of 323.39 g/mol. Its IUPAC name is [(1S)-3-oxo-2-[(2S)-4-phenylbutan-2-yl]-1H-isoindol-1-yl] acetate.
| Compound Name | [(1S)-3-oxo-2-[(2S)-4-phenylbutan-2-yl]-1H-isoindol-1-yl] acetate |
|---|---|
| PubChem CID | 31114025 |
| Molecular Formula | C20H21NO3 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | [(1S)-3-oxo-2-[(2S)-4-phenylbutan-2-yl]-1H-isoindol-1-yl] acetate |
| SMILES | CC(=O)O[C@H]1c2ccccc2C(=O)N1[C@@H](C)CCc1ccccc1 |
| InChI | InChI=1S/C20H21NO3/c1-14(12-13-16-8-4-3-5-9-16)21-19(23)17-10-6-7-11-18(17)20(21)24-15(2)22/h3-11,14,20H,12-13H2,1-2H3/t14-,20-/m0/s1 |
| InChIKey | QWMWZEMANMVJOO-XOBRGWDASA-N |
| XLogP | 3.73 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |