C31H28FN3O2 — CID 5123724
N-(2-fluorophenyl)-4-[[3-oxo-2-(4-phenylbutan-2-yl)-1H-isoindol-1-yl]amino]benzamide (PubChem CID 5123724) has the molecular formula C31H28FN3O2 and a molecular weight of 493.58 g/mol. Its IUPAC name is N-(2-fluorophenyl)-4-[[3-oxo-2-(4-phenylbutan-2-yl)-1H-isoindol-1-yl]amino]benzamide.
| Compound Name | N-(2-fluorophenyl)-4-[[3-oxo-2-(4-phenylbutan-2-yl)-1H-isoindol-1-yl]amino]benzamide |
|---|---|
| PubChem CID | 5123724 |
| Molecular Formula | C31H28FN3O2 |
| Molecular Weight | 493.58 g/mol |
| Exact Mass | 493.22 |
| IUPAC Name | N-(2-fluorophenyl)-4-[[3-oxo-2-(4-phenylbutan-2-yl)-1H-isoindol-1-yl]amino]benzamide |
| SMILES | CC(CCc1ccccc1)N1C(=O)c2ccccc2C1Nc1ccc(C(=O)Nc2ccccc2F)cc1 |
| InChI | InChI=1S/C31H28FN3O2/c1-21(15-16-22-9-3-2-4-10-22)35-29(25-11-5-6-12-26(25)31(35)37)33-24-19-17-23(18-20-24)30(36)34-28-14-8-7-13-27(28)32/h2-14,17-21,29,33H,15-16H2,1H3,(H,34,36) |
| InChIKey | PLHWTVICDDRAFU-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.58 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |