C33H33N3O2 — CID 42663547
N-benzhydryl-4-[[2-(3-methylbutyl)-3-oxo-1H-isoindol-1-yl]amino]benzamide (PubChem CID 42663547) has the molecular formula C33H33N3O2 and a molecular weight of 503.65 g/mol. Its IUPAC name is N-benzhydryl-4-[[2-(3-methylbutyl)-3-oxo-1H-isoindol-1-yl]amino]benzamide.
| Compound Name | N-benzhydryl-4-[[2-(3-methylbutyl)-3-oxo-1H-isoindol-1-yl]amino]benzamide |
|---|---|
| PubChem CID | 42663547 |
| Molecular Formula | C33H33N3O2 |
| Molecular Weight | 503.65 g/mol |
| Exact Mass | 503.26 |
| IUPAC Name | N-benzhydryl-4-[[2-(3-methylbutyl)-3-oxo-1H-isoindol-1-yl]amino]benzamide |
| SMILES | CC(C)CCN1C(=O)c2ccccc2C1Nc1ccc(C(=O)NC(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C33H33N3O2/c1-23(2)21-22-36-31(28-15-9-10-16-29(28)33(36)38)34-27-19-17-26(18-20-27)32(37)35-30(24-11-5-3-6-12-24)25-13-7-4-8-14-25/h3-20,23,30-31,34H,21-22H2,1-2H3,(H,35,37) |
| InChIKey | GGLJCLGKSGSXMO-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.65 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |