C26H27N3O2 — CID 3995947
N-benzyl-4-[[2-(2-methylpropyl)-3-oxo-1H-isoindol-1-yl]amino]benzamide (PubChem CID 3995947) has the molecular formula C26H27N3O2 and a molecular weight of 413.52 g/mol. Its IUPAC name is N-benzyl-4-[[2-(2-methylpropyl)-3-oxo-1H-isoindol-1-yl]amino]benzamide.
| Compound Name | N-benzyl-4-[[2-(2-methylpropyl)-3-oxo-1H-isoindol-1-yl]amino]benzamide |
|---|---|
| PubChem CID | 3995947 |
| Molecular Formula | C26H27N3O2 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | N-benzyl-4-[[2-(2-methylpropyl)-3-oxo-1H-isoindol-1-yl]amino]benzamide |
| SMILES | CC(C)CN1C(=O)c2ccccc2C1Nc1ccc(C(=O)NCc2ccccc2)cc1 |
| InChI | InChI=1S/C26H27N3O2/c1-18(2)17-29-24(22-10-6-7-11-23(22)26(29)31)28-21-14-12-20(13-15-21)25(30)27-16-19-8-4-3-5-9-19/h3-15,18,24,28H,16-17H2,1-2H3,(H,27,30) |
| InChIKey | JTYSZWXUAHGXKF-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |