C28H21F2N3O2 — CID 42765834
N-(2-fluorophenyl)-4-[[2-[(4-fluorophenyl)methyl]-3-oxo-1H-isoindol-1-yl]amino]benzamide (PubChem CID 42765834) has the molecular formula C28H21F2N3O2 and a molecular weight of 469.49 g/mol. Its IUPAC name is N-(2-fluorophenyl)-4-[[2-[(4-fluorophenyl)methyl]-3-oxo-1H-isoindol-1-yl]amino]benzamide.
| Compound Name | N-(2-fluorophenyl)-4-[[2-[(4-fluorophenyl)methyl]-3-oxo-1H-isoindol-1-yl]amino]benzamide |
|---|---|
| PubChem CID | 42765834 |
| Molecular Formula | C28H21F2N3O2 |
| Molecular Weight | 469.49 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | N-(2-fluorophenyl)-4-[[2-[(4-fluorophenyl)methyl]-3-oxo-1H-isoindol-1-yl]amino]benzamide |
| SMILES | O=C(Nc1ccccc1F)c1ccc(NC2c3ccccc3C(=O)N2Cc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C28H21F2N3O2/c29-20-13-9-18(10-14-20)17-33-26(22-5-1-2-6-23(22)28(33)35)31-21-15-11-19(12-16-21)27(34)32-25-8-4-3-7-24(25)30/h1-16,26,31H,17H2,(H,32,34) |
| InChIKey | VRSJEZMYTBKTGZ-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.49 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |