C27H27N3O4 — CID 4244279
4-[[2-(1,3-benzodioxol-5-ylmethyl)-3-oxo-1H-isoindol-1-yl]amino]-N-butylbenzamide (PubChem CID 4244279) has the molecular formula C27H27N3O4 and a molecular weight of 457.53 g/mol. Its IUPAC name is 4-[[2-(1,3-benzodioxol-5-ylmethyl)-3-oxo-1H-isoindol-1-yl]amino]-N-butylbenzamide.
| Compound Name | 4-[[2-(1,3-benzodioxol-5-ylmethyl)-3-oxo-1H-isoindol-1-yl]amino]-N-butylbenzamide |
|---|---|
| PubChem CID | 4244279 |
| Molecular Formula | C27H27N3O4 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | 4-[[2-(1,3-benzodioxol-5-ylmethyl)-3-oxo-1H-isoindol-1-yl]amino]-N-butylbenzamide |
| SMILES | CCCCNC(=O)c1ccc(NC2c3ccccc3C(=O)N2Cc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C27H27N3O4/c1-2-3-14-28-26(31)19-9-11-20(12-10-19)29-25-21-6-4-5-7-22(21)27(32)30(25)16-18-8-13-23-24(15-18)34-17-33-23/h4-13,15,25,29H,2-3,14,16-17H2,1H3,(H,28,31) |
| InChIKey | IOAXXFKIWIFJSV-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|