C19H21BrClN3O4S — CID 31115509
(3aR,7aS)-2-[[4-(4-bromo-2-chlorophenyl)sulfonylpiperazin-1-yl]methyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 31115509) has the molecular formula C19H21BrClN3O4S and a molecular weight of 502.82 g/mol. Its IUPAC name is (3aR,7aS)-2-[[4-(4-bromo-2-chlorophenyl)sulfonylpiperazin-1-yl]methyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aR,7aS)-2-[[4-(4-bromo-2-chlorophenyl)sulfonylpiperazin-1-yl]methyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 31115509 |
| Molecular Formula | C19H21BrClN3O4S |
| Molecular Weight | 502.82 g/mol |
| Exact Mass | 501.01 |
| IUPAC Name | (3aR,7aS)-2-[[4-(4-bromo-2-chlorophenyl)sulfonylpiperazin-1-yl]methyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | O=C1[C@H]2CC=CC[C@H]2C(=O)N1CN1CCN(S(=O)(=O)c2ccc(Br)cc2Cl)CC1 |
| InChI | InChI=1S/C19H21BrClN3O4S/c20-13-5-6-17(16(21)11-13)29(27,28)23-9-7-22(8-10-23)12-24-18(25)14-3-1-2-4-15(14)19(24)26/h1-2,5-6,11,14-15H,3-4,7-10,12H2/t14-,15+ |
| InChIKey | NRFDFJPCUYREJO-GASCZTMLSA-N |
| XLogP | 2.32 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.82 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|