C15H21BrClNO2S — CID 63420879
1-(4-bromo-2-chlorophenyl)sulfonyl-4-tert-butylpiperidine (PubChem CID 63420879) has the molecular formula C15H21BrClNO2S and a molecular weight of 394.76 g/mol. Its IUPAC name is 1-(4-bromo-2-chlorophenyl)sulfonyl-4-tert-butylpiperidine.
| Compound Name | 1-(4-bromo-2-chlorophenyl)sulfonyl-4-tert-butylpiperidine |
|---|---|
| PubChem CID | 63420879 |
| Molecular Formula | C15H21BrClNO2S |
| Molecular Weight | 394.76 g/mol |
| Exact Mass | 393.02 |
| IUPAC Name | 1-(4-bromo-2-chlorophenyl)sulfonyl-4-tert-butylpiperidine |
| SMILES | CC(C)(C)C1CCN(S(=O)(=O)c2ccc(Br)cc2Cl)CC1 |
| InChI | InChI=1S/C15H21BrClNO2S/c1-15(2,3)11-6-8-18(9-7-11)21(19,20)14-5-4-12(16)10-13(14)17/h4-5,10-11H,6-9H2,1-3H3 |
| InChIKey | JLKKPLIBKJXJGU-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.76 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |