C20H20ClN3O4S — CID 31118051
N'-[2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)acetyl]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbohydrazide (PubChem CID 31118051) has the molecular formula C20H20ClN3O4S and a molecular weight of 433.92 g/mol. Its IUPAC name is N'-[2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)acetyl]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbohydrazide.
| Compound Name | N'-[2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)acetyl]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 31118051 |
| Molecular Formula | C20H20ClN3O4S |
| Molecular Weight | 433.92 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | N'-[2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)acetyl]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbohydrazide |
| SMILES | O=C(CN1C(=O)COc2ccc(Cl)cc21)NNC(=O)c1cc2c(s1)CCCCC2 |
| InChI | InChI=1S/C20H20ClN3O4S/c21-13-6-7-15-14(9-13)24(19(26)11-28-15)10-18(25)22-23-20(27)17-8-12-4-2-1-3-5-16(12)29-17/h6-9H,1-5,10-11H2,(H,22,25)(H,23,27) |
| InChIKey | FJMVBQOFWCBDSQ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.92 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|