C21H20N4O2S2 — CID 31147486
3-ethyl-2-[(3-phenyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 31147486) has the molecular formula C21H20N4O2S2 and a molecular weight of 424.55 g/mol. Its IUPAC name is 3-ethyl-2-[(3-phenyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 3-ethyl-2-[(3-phenyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 31147486 |
| Molecular Formula | C21H20N4O2S2 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | 3-ethyl-2-[(3-phenyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | CCn1c(SCc2nc(-c3ccccc3)no2)nc2sc3c(c2c1=O)CCCC3 |
| InChI | InChI=1S/C21H20N4O2S2/c1-2-25-20(26)17-14-10-6-7-11-15(14)29-19(17)23-21(25)28-12-16-22-18(24-27-16)13-8-4-3-5-9-13/h3-5,8-9H,2,6-7,10-12H2,1H3 |
| InChIKey | FBVZZVBJOXTECI-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 73.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |