C23H24N4O3S2 — CID 36682664
3-(2-methoxyphenyl)-2-[(3-propyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 36682664) has the molecular formula C23H24N4O3S2 and a molecular weight of 468.60 g/mol. Its IUPAC name is 3-(2-methoxyphenyl)-2-[(3-propyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 3-(2-methoxyphenyl)-2-[(3-propyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 36682664 |
| Molecular Formula | C23H24N4O3S2 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | 3-(2-methoxyphenyl)-2-[(3-propyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | CCCc1noc(CSc2nc3sc4c(c3c(=O)n2-c2ccccc2OC)CCCC4)n1 |
| InChI | InChI=1S/C23H24N4O3S2/c1-3-8-18-24-19(30-26-18)13-31-23-25-21-20(14-9-4-7-12-17(14)32-21)22(28)27(23)15-10-5-6-11-16(15)29-2/h5-6,10-11H,3-4,7-9,12-13H2,1-2H3 |
| InChIKey | MLSJQVFETNRINW-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 83.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |