C28H27N3O3S3 — CID 2452261
3-(2-methoxyphenyl)-2-[[(5S)-2-(4-methoxyphenyl)-4,5-dihydro-1,3-thiazol-5-yl]methylsulfanyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 2452261) has the molecular formula C28H27N3O3S3 and a molecular weight of 549.74 g/mol. Its IUPAC name is 3-(2-methoxyphenyl)-2-[[(5S)-2-(4-methoxyphenyl)-4,5-dihydro-1,3-thiazol-5-yl]methylsulfanyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 3-(2-methoxyphenyl)-2-[[(5S)-2-(4-methoxyphenyl)-4,5-dihydro-1,3-thiazol-5-yl]methylsulfanyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 2452261 |
| Molecular Formula | C28H27N3O3S3 |
| Molecular Weight | 549.74 g/mol |
| Exact Mass | 549.12 |
| IUPAC Name | 3-(2-methoxyphenyl)-2-[[(5S)-2-(4-methoxyphenyl)-4,5-dihydro-1,3-thiazol-5-yl]methylsulfanyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | COc1ccc(C2=NC[C@@H](CSc3nc4sc5c(c4c(=O)n3-c3ccccc3OC)CCCC5)S2)cc1 |
| InChI | InChI=1S/C28H27N3O3S3/c1-33-18-13-11-17(12-14-18)25-29-15-19(36-25)16-35-28-30-26-24(20-7-3-6-10-23(20)37-26)27(32)31(28)21-8-4-5-9-22(21)34-2/h4-5,8-9,11-14,19H,3,6-7,10,15-16H2,1-2H3/t19-/m0/s1 |
| InChIKey | ZLAXWIVJYLGAPP-IBGZPJMESA-N |
| XLogP | 6.00 |
| TPSA | 65.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.74 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |